C18H15N5O2S2 — CID 45034464
1-[(5-acetyl-4-amino-2-phenyl-6-thia-1,8,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,4,7,9,11-pentaen-12-yl)sulfanyl]propan-2-one (PubChem CID 45034464) has the molecular formula C18H15N5O2S2 and a molecular weight of 397.49 g/mol. Its IUPAC name is 1-[(5-acetyl-4-amino-2-phenyl-6-thia-1,8,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,4,7,9,11-pentaen-12-yl)sulfanyl]propan-2-one.
| Compound Name | 1-[(5-acetyl-4-amino-2-phenyl-6-thia-1,8,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,4,7,9,11-pentaen-12-yl)sulfanyl]propan-2-one |
|---|---|
| PubChem CID | 45034464 |
| Molecular Formula | C18H15N5O2S2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 1-[(5-acetyl-4-amino-2-phenyl-6-thia-1,8,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,4,7,9,11-pentaen-12-yl)sulfanyl]propan-2-one |
| SMILES | CC(=O)CSc1nnc2nc3sc(C(C)=O)c(N)c3c(-c3ccccc3)n12 |
| InChI | InChI=1S/C18H15N5O2S2/c1-9(24)8-26-18-22-21-17-20-16-12(13(19)15(27-16)10(2)25)14(23(17)18)11-6-4-3-5-7-11/h3-7H,8,19H2,1-2H3 |
| InChIKey | QCMRWOCOUMHYDC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |