C24H20IN5O5 — CID 45037322
N-(4-iodo-2-methylphenyl)-2-[2-methyl-3-[(E)-2-(5-nitro-4,6-dioxo-1H-pyrimidin-2-yl)ethenyl]indol-1-yl]acetamide (PubChem CID 45037322) has the molecular formula C24H20IN5O5 and a molecular weight of 585.36 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-[2-methyl-3-[(E)-2-(5-nitro-4,6-dioxo-1H-pyrimidin-2-yl)ethenyl]indol-1-yl]acetamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-[2-methyl-3-[(E)-2-(5-nitro-4,6-dioxo-1H-pyrimidin-2-yl)ethenyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 45037322 |
| Molecular Formula | C24H20IN5O5 |
| Molecular Weight | 585.36 g/mol |
| Exact Mass | 585.05 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-[2-methyl-3-[(E)-2-(5-nitro-4,6-dioxo-1H-pyrimidin-2-yl)ethenyl]indol-1-yl]acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)Cn1c(C)c(/C=C/C2=NC(=O)C([N+](=O)[O-])C(=O)N2)c2ccccc21 |
| InChI | InChI=1S/C24H20IN5O5/c1-13-11-15(25)7-9-18(13)26-21(31)12-29-14(2)16(17-5-3-4-6-19(17)29)8-10-20-27-23(32)22(30(34)35)24(33)28-20/h3-11,22H,12H2,1-2H3,(H,26,31)(H,27,28,32,33)/b10-8+ |
| InChIKey | JEOKTUDJZFFUJW-CSKARUKUSA-N |
| XLogP | 3.21 |
| TPSA | 135.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|