C12H15N5O3 — CID 45039134
2-amino-9-[(1S,3R,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-5H-purin-6-one (PubChem CID 45039134) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-amino-9-[(1S,3R,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-5H-purin-6-one.
| Compound Name | 2-amino-9-[(1S,3R,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-5H-purin-6-one |
|---|---|
| PubChem CID | 45039134 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-amino-9-[(1S,3R,4R)-4-hydroxy-3-(hydroxymethyl)-2-methylidenecyclopentyl]-5H-purin-6-one |
| SMILES | C=C1[C@H](CO)[C@H](O)C[C@@H]1N1C=NC2C(=O)N=C(N)N=C21 |
| InChI | InChI=1S/C12H15N5O3/c1-5-6(3-18)8(19)2-7(5)17-4-14-9-10(17)15-12(13)16-11(9)20/h4,6-9,18-19H,1-3H2,(H2,13,16,20)/t6-,7-,8+,9?/m0/s1 |
| InChIKey | IAVOIUJETMUMJM-VTBDLZGYSA-N |
| XLogP | -1.75 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|