C20H25N5O2Si — CID 10363308
2-amino-9-[(1S,3R,4S)-4-[dimethyl(phenyl)silyl]-3-(hydroxymethyl)-2-methylidenecyclopentyl]-5H-purin-6-one (PubChem CID 10363308) has the molecular formula C20H25N5O2Si and a molecular weight of 395.54 g/mol. Its IUPAC name is 2-amino-9-[(1S,3R,4S)-4-[dimethyl(phenyl)silyl]-3-(hydroxymethyl)-2-methylidenecyclopentyl]-5H-purin-6-one.
| Compound Name | 2-amino-9-[(1S,3R,4S)-4-[dimethyl(phenyl)silyl]-3-(hydroxymethyl)-2-methylidenecyclopentyl]-5H-purin-6-one |
|---|---|
| PubChem CID | 10363308 |
| Molecular Formula | C20H25N5O2Si |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-amino-9-[(1S,3R,4S)-4-[dimethyl(phenyl)silyl]-3-(hydroxymethyl)-2-methylidenecyclopentyl]-5H-purin-6-one |
| SMILES | C=C1[C@H](CO)[C@@H]([Si](C)(C)c2ccccc2)C[C@@H]1N1C=NC2C(=O)N=C(N)N=C21 |
| InChI | InChI=1S/C20H25N5O2Si/c1-12-14(10-26)16(28(2,3)13-7-5-4-6-8-13)9-15(12)25-11-22-17-18(25)23-20(21)24-19(17)27/h4-8,11,14-17,26H,1,9-10H2,2-3H3,(H2,21,24,27)/t14-,15-,16-,17?/m0/s1 |
| InChIKey | YVVYVAYZDNLEEK-RXMKTKRKSA-N |
| XLogP | 0.88 |
| TPSA | 103.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|