C20H19Cl2N3O4 — CID 4503940
4-(2,4-dichlorophenoxy)-N-(2-hydroxy-5-methoxy-1-methylindol-3-yl)iminobutanamide (PubChem CID 4503940) has the molecular formula C20H19Cl2N3O4 and a molecular weight of 436.30 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(2-hydroxy-5-methoxy-1-methylindol-3-yl)iminobutanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(2-hydroxy-5-methoxy-1-methylindol-3-yl)iminobutanamide |
|---|---|
| PubChem CID | 4503940 |
| Molecular Formula | C20H19Cl2N3O4 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(2-hydroxy-5-methoxy-1-methylindol-3-yl)iminobutanamide |
| SMILES | COc1ccc2c(c1)c(/N=N/C(=O)CCCOc1ccc(Cl)cc1Cl)c(O)n2C |
| InChI | InChI=1S/C20H19Cl2N3O4/c1-25-16-7-6-13(28-2)11-14(16)19(20(25)27)24-23-18(26)4-3-9-29-17-8-5-12(21)10-15(17)22/h5-8,10-11,27H,3-4,9H2,1-2H3/b24-23+ |
| InChIKey | NLCNOOCOHWQCEW-WCWDXBQESA-N |
| XLogP | 5.67 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|