C12H18N3OS+ — CID 45045650
(4Z)-2,5-dimethyl-4-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]-1-sulfanylidenepyrazolidin-1-ium-3-one (PubChem CID 45045650) has the molecular formula C12H18N3OS+ and a molecular weight of 252.36 g/mol. Its IUPAC name is (4Z)-2,5-dimethyl-4-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]-1-sulfanylidenepyrazolidin-1-ium-3-one.
| Compound Name | (4Z)-2,5-dimethyl-4-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]-1-sulfanylidenepyrazolidin-1-ium-3-one |
|---|---|
| PubChem CID | 45045650 |
| Molecular Formula | C12H18N3OS+ |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (4Z)-2,5-dimethyl-4-[(2E)-2-(1-methylpyrrolidin-2-ylidene)ethylidene]-1-sulfanylidenepyrazolidin-1-ium-3-one |
| SMILES | CC1/C(=C/C=C2\CCCN2C)C(=O)N(C)[N+]1=S |
| InChI | InChI=1S/C12H18N3OS/c1-9-11(12(16)14(3)15(9)17)7-6-10-5-4-8-13(10)2/h6-7,9H,4-5,8H2,1-3H3/q+1/b10-6+,11-7- |
| InChIKey | SAONRIMITKYUQT-QZTBCQRESA-N |
| XLogP | 1.04 |
| TPSA | 26.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|