C17H22N2O3 — CID 59887623
4-hydroxy-2,5-bis[(1-methylpyrrolidin-2-ylidene)methyl]cyclopent-4-ene-1,3-dione (PubChem CID 59887623) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-hydroxy-2,5-bis[(1-methylpyrrolidin-2-ylidene)methyl]cyclopent-4-ene-1,3-dione.
| Compound Name | 4-hydroxy-2,5-bis[(1-methylpyrrolidin-2-ylidene)methyl]cyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 59887623 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4-hydroxy-2,5-bis[(1-methylpyrrolidin-2-ylidene)methyl]cyclopent-4-ene-1,3-dione |
| SMILES | CN1CCCC1=CC1=C(O)C(=O)C(C=C2CCCN2C)C1=O |
| InChI | InChI=1S/C17H22N2O3/c1-18-7-3-5-11(18)9-13-15(20)14(17(22)16(13)21)10-12-6-4-8-19(12)2/h9-10,13,22H,3-8H2,1-2H3 |
| InChIKey | CTRHLHSUDPHALA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|