C7H11NO3 — CID 45084474
(2S,3R)-3-butanoyloxirane-2-carboxamide (PubChem CID 45084474) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is (2S,3R)-3-butanoyloxirane-2-carboxamide.
| Compound Name | (2S,3R)-3-butanoyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 45084474 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (2S,3R)-3-butanoyloxirane-2-carboxamide |
| SMILES | CCCC(=O)[C@@H]1O[C@@H]1C(N)=O |
| InChI | InChI=1S/C7H11NO3/c1-2-3-4(9)5-6(11-5)7(8)10/h5-6H,2-3H2,1H3,(H2,8,10)/t5-,6-/m0/s1 |
| InChIKey | VMMWDYJVQWQJDX-WDSKDSINSA-N |
| XLogP | -0.39 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|