C8H15BN2O4 — CID 102103508
(4R,5R)-2-butyl-1,3,2-dioxaborolane-4,5-dicarboxamide (PubChem CID 102103508) has the molecular formula C8H15BN2O4 and a molecular weight of 214.03 g/mol. Its IUPAC name is (4R,5R)-2-butyl-1,3,2-dioxaborolane-4,5-dicarboxamide.
| Compound Name | (4R,5R)-2-butyl-1,3,2-dioxaborolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 102103508 |
| Molecular Formula | C8H15BN2O4 |
| Molecular Weight | 214.03 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (4R,5R)-2-butyl-1,3,2-dioxaborolane-4,5-dicarboxamide |
| SMILES | CCCCB1O[C@@H](C(N)=O)[C@H](C(N)=O)O1 |
| InChI | InChI=1S/C8H15BN2O4/c1-2-3-4-9-14-5(7(10)12)6(15-9)8(11)13/h5-6H,2-4H2,1H3,(H2,10,12)(H2,11,13)/t5-,6-/m1/s1 |
| InChIKey | ARMSAEHTGXEQJZ-PHDIDXHHSA-N |
| XLogP | -0.97 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.03 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|