1-prop-2-enylcyclopentane-1-carboxylic acid

C9H14O2 — CID 45084789

IUPAC1-prop-2-enylcyclopentane-1-carboxylic acid
SMILESC=CCC1(C(=O)O)CCCC1
InChIInChI=1S/C9H14O2/c1-2-5-9(8(10)11)6-3-4-7-9/h2H,1,3-7H2,(H,10,11)
InChIKeyOURQETBSYVIMIZ-UHFFFAOYSA-N
MW154.21 g/mol
LogP2.21
Rot. Bonds3

About 1-prop-2-enylcyclopentane-1-carboxylic acid

1-prop-2-enylcyclopentane-1-carboxylic acid (PubChem CID 45084789) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-prop-2-enylcyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name1-prop-2-enylcyclopentane-1-carboxylic acid
PubChem CID45084789
Molecular FormulaC9H14O2
Molecular Weight154.21 g/mol
Exact Mass154.10
IUPAC Name1-prop-2-enylcyclopentane-1-carboxylic acid
SMILESC=CCC1(C(=O)O)CCCC1
InChIInChI=1S/C9H14O2/c1-2-5-9(8(10)11)6-3-4-7-9/h2H,1,3-7H2,(H,10,11)
InChIKeyOURQETBSYVIMIZ-UHFFFAOYSA-N
XLogP2.21
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.21
LogP ≤ 52.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 1-prop-2-enylcyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2,2-Dimethylhept-6-enoic acid
CID 15680403
1-(Prop-2-en-1-yl)cyclobutane-1-carboxylic acid
CID 54460225
1-Ethenylcyclopentane-1-carboxylic acid
CID 17802802
1-Methyl-3-methylidenecyclopentane-1-carboxylic acid
CID 18614396
1-(But-3-en-1-yl)cyclobutane-1-carboxylic acid
CID 79425082
(3R)-3-methylhept-6-enoic acid
CID 11018976
(3S)-3-methylhept-6-enoic acid
CID 11815469
2-Prop-2-enylhexanoic acid
CID 13010742
3-Vinylhexanedioic acid
CID 13139332
2-(4,4-Dimethylcyclopent-2-en-1-yl)acetic acid
CID 13610273
3-Ethenylhexanoic acid
CID 22447322
2-(1,5,5-Trimethylcyclopent-2-en-1-yl)acetic acid
CID 46944497

Frequently Asked Questions

What is the IUPAC name of 1-prop-2-enylcyclopentane-1-carboxylic acid?
The IUPAC name of 1-prop-2-enylcyclopentane-1-carboxylic acid (CID 45084789) is 1-prop-2-enylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-prop-2-enylcyclopentane-1-carboxylic acid?
The canonical SMILES for 1-prop-2-enylcyclopentane-1-carboxylic acid is C=CCC1(C(=O)O)CCCC1.
What is the InChIKey of 1-prop-2-enylcyclopentane-1-carboxylic acid?
The InChIKey is OURQETBSYVIMIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-2-5-9(8(10)11)6-3-4-7-9/h2H,1,3-7H2,(H,10,11).
What are the key properties of 1-prop-2-enylcyclopentane-1-carboxylic acid?
1-prop-2-enylcyclopentane-1-carboxylic acid has a molecular weight of 154.21 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 45084789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).