C10H17N — CID 45091747
2-butyl-4-methyl-1,2-dihydropyridine (PubChem CID 45091747) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 2-butyl-4-methyl-1,2-dihydropyridine.
| Compound Name | 2-butyl-4-methyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 45091747 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2-butyl-4-methyl-1,2-dihydropyridine |
| SMILES | CCCCC1C=C(C)C=CN1 |
| InChI | InChI=1S/C10H17N/c1-3-4-5-10-8-9(2)6-7-11-10/h6-8,10-11H,3-5H2,1-2H3 |
| InChIKey | XGNJXUSQGJZIOD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |