C12H20O3 — CID 45094293
(3R,3aS,7aR)-3-ethoxy-7,7-dimethyl-1,3,3a,4,6,7a-hexahydro-2-benzofuran-5-one (PubChem CID 45094293) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (3R,3aS,7aR)-3-ethoxy-7,7-dimethyl-1,3,3a,4,6,7a-hexahydro-2-benzofuran-5-one.
| Compound Name | (3R,3aS,7aR)-3-ethoxy-7,7-dimethyl-1,3,3a,4,6,7a-hexahydro-2-benzofuran-5-one |
|---|---|
| PubChem CID | 45094293 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (3R,3aS,7aR)-3-ethoxy-7,7-dimethyl-1,3,3a,4,6,7a-hexahydro-2-benzofuran-5-one |
| SMILES | CCO[C@@H]1OC[C@@H]2[C@@H]1CC(=O)CC2(C)C |
| InChI | InChI=1S/C12H20O3/c1-4-14-11-9-5-8(13)6-12(2,3)10(9)7-15-11/h9-11H,4-7H2,1-3H3/t9-,10+,11+/m0/s1 |
| InChIKey | WXXRZUXRKRIXTA-HBNTYKKESA-N |
| XLogP | 2.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |