About 6,8-dimethoxy-3,7-dimethylpurin-2-one
6,8-dimethoxy-3,7-dimethylpurin-2-one (PubChem CID 45097833) has the molecular formula C9H12N4O3
and a molecular weight of 224.22 g/mol. Its IUPAC name is 6,8-dimethoxy-3,7-dimethylpurin-2-one.
Molecular Properties
| Compound Name | 6,8-dimethoxy-3,7-dimethylpurin-2-one |
| PubChem CID | 45097833 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 6,8-dimethoxy-3,7-dimethylpurin-2-one |
| SMILES | COc1nc(=O)n(C)c2nc(OC)n(C)c12 |
| InChI | InChI=1S/C9H12N4O3/c1-12-5-6(10-9(12)16-4)13(2)8(14)11-7(5)15-3/h1-4H3 |
| InChIKey | ANNNKMUSAVQMCY-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6,8-dimethoxy-3,7-dimethylpurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethoxy-3,7-dimethylpurin-2-one?
The IUPAC name of 6,8-dimethoxy-3,7-dimethylpurin-2-one (CID 45097833) is 6,8-dimethoxy-3,7-dimethylpurin-2-one.
What is the SMILES notation for 6,8-dimethoxy-3,7-dimethylpurin-2-one?
The canonical SMILES for 6,8-dimethoxy-3,7-dimethylpurin-2-one is COc1nc(=O)n(C)c2nc(OC)n(C)c12.
What is the InChIKey of 6,8-dimethoxy-3,7-dimethylpurin-2-one?
The InChIKey is ANNNKMUSAVQMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O3/c1-12-5-6(10-9(12)16-4)13(2)8(14)11-7(5)15-3/h1-4H3.
What are the key properties of 6,8-dimethoxy-3,7-dimethylpurin-2-one?
6,8-dimethoxy-3,7-dimethylpurin-2-one has a molecular weight of 224.22 g/mol, XLogP of -0.32, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethoxy-3,7-dimethylpurin-2-one is sourced from PubChem (CID 45097833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).