C9H12N4O3 — CID 45097833
6,8-dimethoxy-3,7-dimethylpurin-2-one (PubChem CID 45097833) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 6,8-dimethoxy-3,7-dimethylpurin-2-one.
| Compound Name | 6,8-dimethoxy-3,7-dimethylpurin-2-one |
|---|---|
| PubChem CID | 45097833 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 6,8-dimethoxy-3,7-dimethylpurin-2-one |
| SMILES | COc1nc(=O)n(C)c2nc(OC)n(C)c12 |
| InChI | InChI=1S/C9H12N4O3/c1-12-5-6(10-9(12)16-4)13(2)8(14)11-7(5)15-3/h1-4H3 |
| InChIKey | ANNNKMUSAVQMCY-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |