C23H16N2O2S — CID 45112101
2-(3-nitrophenyl)-9-phenyl-2,3-dihydrothieno[3,2-b]quinoline (PubChem CID 45112101) has the molecular formula C23H16N2O2S and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-9-phenyl-2,3-dihydrothieno[3,2-b]quinoline.
| Compound Name | 2-(3-nitrophenyl)-9-phenyl-2,3-dihydrothieno[3,2-b]quinoline |
|---|---|
| PubChem CID | 45112101 |
| Molecular Formula | C23H16N2O2S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-(3-nitrophenyl)-9-phenyl-2,3-dihydrothieno[3,2-b]quinoline |
| SMILES | O=[N+]([O-])c1cccc(C2Cc3nc4ccccc4c(-c4ccccc4)c3S2)c1 |
| InChI | InChI=1S/C23H16N2O2S/c26-25(27)17-10-6-9-16(13-17)21-14-20-23(28-21)22(15-7-2-1-3-8-15)18-11-4-5-12-19(18)24-20/h1-13,21H,14H2 |
| InChIKey | QGXQEPQFICMDHB-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|