C25H25N3O2S — CID 45113534
8-(benzenesulfonyl)-2-methyl-5-(2-pyridin-2-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 45113534) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-2-methyl-5-(2-pyridin-2-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-(benzenesulfonyl)-2-methyl-5-(2-pyridin-2-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 45113534 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 8-(benzenesulfonyl)-2-methyl-5-(2-pyridin-2-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | CN1CCc2c(c3cc(S(=O)(=O)c4ccccc4)ccc3n2CCc2ccccn2)C1 |
| InChI | InChI=1S/C25H25N3O2S/c1-27-15-13-25-23(18-27)22-17-21(31(29,30)20-8-3-2-4-9-20)10-11-24(22)28(25)16-12-19-7-5-6-14-26-19/h2-11,14,17H,12-13,15-16,18H2,1H3 |
| InChIKey | JYMNPISZAQIASA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|