C19H14Cl3NO4 — CID 45117942
4,6-dimethoxy-3-phenyl-7-(2,2,2-trichloroacetyl)-1H-indole-2-carbaldehyde (PubChem CID 45117942) has the molecular formula C19H14Cl3NO4 and a molecular weight of 426.68 g/mol. Its IUPAC name is 4,6-dimethoxy-3-phenyl-7-(2,2,2-trichloroacetyl)-1H-indole-2-carbaldehyde.
| Compound Name | 4,6-dimethoxy-3-phenyl-7-(2,2,2-trichloroacetyl)-1H-indole-2-carbaldehyde |
|---|---|
| PubChem CID | 45117942 |
| Molecular Formula | C19H14Cl3NO4 |
| Molecular Weight | 426.68 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 4,6-dimethoxy-3-phenyl-7-(2,2,2-trichloroacetyl)-1H-indole-2-carbaldehyde |
| SMILES | COc1cc(OC)c2c(-c3ccccc3)c(C=O)[nH]c2c1C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H14Cl3NO4/c1-26-12-8-13(27-2)16(18(25)19(20,21)22)17-15(12)14(11(9-24)23-17)10-6-4-3-5-7-10/h3-9,23H,1-2H3 |
| InChIKey | AFLLJYBWGCOZPV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.68 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|