C15H25N3O4 — CID 45137175
N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-but-2-ynoxycyclohexane-1-carboxamide (PubChem CID 45137175) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-but-2-ynoxycyclohexane-1-carboxamide.
| Compound Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-but-2-ynoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 45137175 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-but-2-ynoxycyclohexane-1-carboxamide |
| SMILES | CC#CCOC1CCC(C(=O)N[C@H](C(=O)NO)[C@@H](C)N)CC1 |
| InChI | InChI=1S/C15H25N3O4/c1-3-4-9-22-12-7-5-11(6-8-12)14(19)17-13(10(2)16)15(20)18-21/h10-13,21H,5-9,16H2,1-2H3,(H,17,19)(H,18,20)/t10-,11?,12?,13+/m1/s1 |
| InChIKey | PYMXQIVDCHTBAC-XVSSEFHLSA-N |
| XLogP | -0.08 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|