C16H21IO2S — CID 45141197
(2E,4Z)-9-iodo-4-[(R)-(4-methylphenyl)sulfinyl]nona-2,4-dien-1-ol (PubChem CID 45141197) has the molecular formula C16H21IO2S and a molecular weight of 404.31 g/mol. Its IUPAC name is (2E,4Z)-9-iodo-4-[(R)-(4-methylphenyl)sulfinyl]nona-2,4-dien-1-ol.
| Compound Name | (2E,4Z)-9-iodo-4-[(R)-(4-methylphenyl)sulfinyl]nona-2,4-dien-1-ol |
|---|---|
| PubChem CID | 45141197 |
| Molecular Formula | C16H21IO2S |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | (2E,4Z)-9-iodo-4-[(R)-(4-methylphenyl)sulfinyl]nona-2,4-dien-1-ol |
| SMILES | Cc1ccc([S@](=O)C(=C\CCCCI)/C=C/CO)cc1 |
| InChI | InChI=1S/C16H21IO2S/c1-14-8-10-16(11-9-14)20(19)15(7-5-13-18)6-3-2-4-12-17/h5-11,18H,2-4,12-13H2,1H3/b7-5+,15-6-/t20-/m1/s1 |
| InChIKey | NGWOKCVXJOVVEU-NDVPHLFQSA-N |
| XLogP | 4.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|