C14H11Cl2N3O2S — CID 45142534
N-[5-(dichloromethyl)-6-oxoimidazo[2,1-b][1,3]thiazol-5-yl]-4-methylbenzamide (PubChem CID 45142534) has the molecular formula C14H11Cl2N3O2S and a molecular weight of 356.23 g/mol. Its IUPAC name is N-[5-(dichloromethyl)-6-oxoimidazo[2,1-b][1,3]thiazol-5-yl]-4-methylbenzamide.
| Compound Name | N-[5-(dichloromethyl)-6-oxoimidazo[2,1-b][1,3]thiazol-5-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 45142534 |
| Molecular Formula | C14H11Cl2N3O2S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | N-[5-(dichloromethyl)-6-oxoimidazo[2,1-b][1,3]thiazol-5-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2(C(Cl)Cl)C(=O)N=C3SC=CN32)cc1 |
| InChI | InChI=1S/C14H11Cl2N3O2S/c1-8-2-4-9(5-3-8)10(20)18-14(11(15)16)12(21)17-13-19(14)6-7-22-13/h2-7,11H,1H3,(H,18,20) |
| InChIKey | QBQMGWUJNUCXIT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|