C16H28N4O3S — CID 45201430
2-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 45201430) has the molecular formula C16H28N4O3S and a molecular weight of 356.49 g/mol. Its IUPAC name is 2-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 45201430 |
| Molecular Formula | C16H28N4O3S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 2-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | COCCCn1c(CN2CCN3CCCC3C2)cnc1S(C)(=O)=O |
| InChI | InChI=1S/C16H28N4O3S/c1-23-10-4-7-20-15(11-17-16(20)24(2,21)22)13-18-8-9-19-6-3-5-14(19)12-18/h11,14H,3-10,12-13H2,1-2H3 |
| InChIKey | QCUNBFALGYGUKQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|