C17H22N6O3 — CID 45227664
3-[2-oxo-2-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]ethyl]oxadiazol-3-ium-5-olate (PubChem CID 45227664) has the molecular formula C17H22N6O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-[2-oxo-2-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]ethyl]oxadiazol-3-ium-5-olate.
| Compound Name | 3-[2-oxo-2-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]ethyl]oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 45227664 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-[2-oxo-2-[3-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-1-yl]ethyl]oxadiazol-3-ium-5-olate |
| SMILES | O=C(C[n+]1cc([O-])on1)N1CCC(C2CCN(c3ncccn3)CC2)C1 |
| InChI | InChI=1S/C17H22N6O3/c24-15(11-23-12-16(25)26-20-23)22-9-4-14(10-22)13-2-7-21(8-3-13)17-18-5-1-6-19-17/h1,5-6,12-14H,2-4,7-11H2 |
| InChIKey | HQHCCDNLHDJCRL-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 102.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|