C27H30FN3O2 — CID 45237611
(E)-N-[[2-(dimethylamino)-8-methylquinolin-3-yl]methyl]-3-(3-fluorophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 45237611) has the molecular formula C27H30FN3O2 and a molecular weight of 447.55 g/mol. Its IUPAC name is (E)-N-[[2-(dimethylamino)-8-methylquinolin-3-yl]methyl]-3-(3-fluorophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-[[2-(dimethylamino)-8-methylquinolin-3-yl]methyl]-3-(3-fluorophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 45237611 |
| Molecular Formula | C27H30FN3O2 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | (E)-N-[[2-(dimethylamino)-8-methylquinolin-3-yl]methyl]-3-(3-fluorophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | Cc1cccc2cc(CN(CC3CCCO3)C(=O)/C=C/c3cccc(F)c3)c(N(C)C)nc12 |
| InChI | InChI=1S/C27H30FN3O2/c1-19-7-4-9-21-16-22(27(30(2)3)29-26(19)21)17-31(18-24-11-6-14-33-24)25(32)13-12-20-8-5-10-23(28)15-20/h4-5,7-10,12-13,15-16,24H,6,11,14,17-18H2,1-3H3/b13-12+ |
| InChIKey | HNSRKVVNVMCHNJ-OUKQBFOZSA-N |
| XLogP | 4.97 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|