C24H31NO3S — CID 45239939
N-(oxolan-2-ylmethyl)-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]cyclohexanecarboxamide (PubChem CID 45239939) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]cyclohexanecarboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 45239939 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]cyclohexanecarboxamide |
| SMILES | O=C(C1CCCCC1)N(Cc1ccc(OCc2cccs2)cc1)CC1CCCO1 |
| InChI | InChI=1S/C24H31NO3S/c26-24(20-6-2-1-3-7-20)25(17-22-8-4-14-27-22)16-19-10-12-21(13-11-19)28-18-23-9-5-15-29-23/h5,9-13,15,20,22H,1-4,6-8,14,16-18H2 |
| InChIKey | BPBVHDZXUSJJLW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |