C19H19NO4S — CID 45247014
N-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)-3-naphthalen-2-ylprop-2-ynamide (PubChem CID 45247014) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)-3-naphthalen-2-ylprop-2-ynamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)-3-naphthalen-2-ylprop-2-ynamide |
|---|---|
| PubChem CID | 45247014 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)-3-naphthalen-2-ylprop-2-ynamide |
| SMILES | O=C(C#Cc1ccc2ccccc2c1)N(CCO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H19NO4S/c21-11-10-20(18-9-12-25(23,24)14-18)19(22)8-6-15-5-7-16-3-1-2-4-17(16)13-15/h1-5,7,13,18,21H,9-12,14H2 |
| InChIKey | NDPLEHLTZXAQMH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|