C24H23N3O4 — CID 45255663
(2S,3R)-N,3-dihydroxy-3-imidazo[1,2-a]pyridin-2-yl-2-methyl-2-[(4-phenylphenyl)methoxy]propanamide (PubChem CID 45255663) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is (2S,3R)-N,3-dihydroxy-3-imidazo[1,2-a]pyridin-2-yl-2-methyl-2-[(4-phenylphenyl)methoxy]propanamide.
| Compound Name | (2S,3R)-N,3-dihydroxy-3-imidazo[1,2-a]pyridin-2-yl-2-methyl-2-[(4-phenylphenyl)methoxy]propanamide |
|---|---|
| PubChem CID | 45255663 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (2S,3R)-N,3-dihydroxy-3-imidazo[1,2-a]pyridin-2-yl-2-methyl-2-[(4-phenylphenyl)methoxy]propanamide |
| SMILES | C[C@@](OCc1ccc(-c2ccccc2)cc1)(C(=O)NO)[C@H](O)c1cn2ccccc2n1 |
| InChI | InChI=1S/C24H23N3O4/c1-24(23(29)26-30,22(28)20-15-27-14-6-5-9-21(27)25-20)31-16-17-10-12-19(13-11-17)18-7-3-2-4-8-18/h2-15,22,28,30H,16H2,1H3,(H,26,29)/t22-,24+/m1/s1 |
| InChIKey | PFNDOMLTGRHMJU-VWNXMTODSA-N |
| XLogP | 3.52 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|