C20H20N2O4S — CID 45255464
(2S,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]-3-(1,3-thiazol-5-yl)propanamide (PubChem CID 45255464) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is (2S,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]-3-(1,3-thiazol-5-yl)propanamide.
| Compound Name | (2S,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]-3-(1,3-thiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 45255464 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (2S,3S)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]-3-(1,3-thiazol-5-yl)propanamide |
| SMILES | C[C@@](OCc1ccc(-c2ccccc2)cc1)(C(=O)NO)[C@H](O)c1cncs1 |
| InChI | InChI=1S/C20H20N2O4S/c1-20(19(24)22-25,18(23)17-11-21-13-27-17)26-12-14-7-9-16(10-8-14)15-5-3-2-4-6-15/h2-11,13,18,23,25H,12H2,1H3,(H,22,24)/t18-,20+/m1/s1 |
| InChIKey | PXRWAXKWXVIQQZ-QUCCMNQESA-N |
| XLogP | 3.32 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|