C22H28N2O5 — CID 87355562
(2S,3S)-3-(2,5-dimethyl-1,3-oxazolidin-4-yl)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]propanamide (PubChem CID 87355562) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is (2S,3S)-3-(2,5-dimethyl-1,3-oxazolidin-4-yl)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]propanamide.
| Compound Name | (2S,3S)-3-(2,5-dimethyl-1,3-oxazolidin-4-yl)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]propanamide |
|---|---|
| PubChem CID | 87355562 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (2S,3S)-3-(2,5-dimethyl-1,3-oxazolidin-4-yl)-N,3-dihydroxy-2-methyl-2-[(4-phenylphenyl)methoxy]propanamide |
| SMILES | CC1NC([C@H](O)[C@](C)(OCc2ccc(-c3ccccc3)cc2)C(=O)NO)C(C)O1 |
| InChI | InChI=1S/C22H28N2O5/c1-14-19(23-15(2)29-14)20(25)22(3,21(26)24-27)28-13-16-9-11-18(12-10-16)17-7-5-4-6-8-17/h4-12,14-15,19-20,23,25,27H,13H2,1-3H3,(H,24,26)/t14?,15?,19?,20-,22-/m0/s1 |
| InChIKey | RWOMMMNNMDORNK-JNMRDXGNSA-N |
| XLogP | 2.22 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|