C14H18N2O2S2 — CID 45266383
3-[(2R)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide (PubChem CID 45266383) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-[(2R)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide.
| Compound Name | 3-[(2R)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide |
|---|---|
| PubChem CID | 45266383 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-[(2R)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide |
| SMILES | CNC(=S)[C@]1(c2cccc(C(N)=O)c2)CCCCS1=O |
| InChI | InChI=1S/C14H18N2O2S2/c1-16-13(19)14(7-2-3-8-20(14)18)11-6-4-5-10(9-11)12(15)17/h4-6,9H,2-3,7-8H2,1H3,(H2,15,17)(H,16,19)/t14-,20?/m1/s1 |
| InChIKey | QAJDGAOJHVOWTI-QMRFKDRMSA-N |
| XLogP | 1.46 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|