C20H18N2O2 — CID 45267643
1-(5-methyl-2,3-dihydroindol-1-yl)-2-(5-methyl-1H-indol-3-yl)ethane-1,2-dione (PubChem CID 45267643) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-(5-methyl-2,3-dihydroindol-1-yl)-2-(5-methyl-1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-(5-methyl-2,3-dihydroindol-1-yl)-2-(5-methyl-1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 45267643 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-(5-methyl-2,3-dihydroindol-1-yl)-2-(5-methyl-1H-indol-3-yl)ethane-1,2-dione |
| SMILES | Cc1ccc2c(c1)CCN2C(=O)C(=O)c1c[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C20H18N2O2/c1-12-4-6-18-14(9-12)7-8-22(18)20(24)19(23)16-11-21-17-5-3-13(2)10-15(16)17/h3-6,9-11,21H,7-8H2,1-2H3 |
| InChIKey | BICOMKBAGNUDPP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|