C15H11F2NO3 — CID 45268870
2-[(2,5-difluorophenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one (PubChem CID 45268870) has the molecular formula C15H11F2NO3 and a molecular weight of 291.25 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 45268870 |
| Molecular Formula | C15H11F2NO3 |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-6,7-dihydroxy-3H-isoindol-1-one |
| SMILES | O=C1c2c(ccc(O)c2O)CN1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C15H11F2NO3/c16-10-2-3-11(17)9(5-10)7-18-6-8-1-4-12(19)14(20)13(8)15(18)21/h1-5,19-20H,6-7H2 |
| InChIKey | KRARQHVLTYJHJF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|