C34H52O9 — CID 45271336
[(2R,3S,4R,7S,8S,11S,13R,16E)-17-ethyl-4,8-dihydroxy-3,7,11,13-tetramethyl-6,15-dioxononadeca-16,18-dien-2-yl] (3R)-3-(4-methyl-2,5-dioxofuran-3-yl)butanoate (PubChem CID 45271336) has the molecular formula C34H52O9 and a molecular weight of 604.78 g/mol. Its IUPAC name is [(2R,3S,4R,7S,8S,11S,13R,16E)-17-ethyl-4,8-dihydroxy-3,7,11,13-tetramethyl-6,15-dioxononadeca-16,18-dien-2-yl] (3R)-3-(4-methyl-2,5-dioxofuran-3-yl)butanoate.
| Compound Name | [(2R,3S,4R,7S,8S,11S,13R,16E)-17-ethyl-4,8-dihydroxy-3,7,11,13-tetramethyl-6,15-dioxononadeca-16,18-dien-2-yl] (3R)-3-(4-methyl-2,5-dioxofuran-3-yl)butanoate |
|---|---|
| PubChem CID | 45271336 |
| Molecular Formula | C34H52O9 |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | [(2R,3S,4R,7S,8S,11S,13R,16E)-17-ethyl-4,8-dihydroxy-3,7,11,13-tetramethyl-6,15-dioxononadeca-16,18-dien-2-yl] (3R)-3-(4-methyl-2,5-dioxofuran-3-yl)butanoate |
| SMILES | C=C/C(=C/C(=O)C[C@H](C)C[C@@H](C)CC[C@H](O)[C@H](C)C(=O)C[C@@H](O)[C@H](C)[C@@H](C)OC(=O)C[C@@H](C)C1=C(C)C(=O)OC1=O)CC |
| InChI | InChI=1S/C34H52O9/c1-10-26(11-2)17-27(35)15-20(4)14-19(3)12-13-28(36)23(7)30(38)18-29(37)22(6)25(9)42-31(39)16-21(5)32-24(8)33(40)43-34(32)41/h10,17,19-23,25,28-29,36-37H,1,11-16,18H2,2-9H3/b26-17-/t19-,20+,21+,22+,23-,25+,28-,29+/m0/s1 |
| InChIKey | FBVNXBCHCMKFIO-IVQVYTEOSA-N |
| XLogP | 5.22 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|