C15H10F3NO3 — CID 45271379
6,7-dihydroxy-2-[(2,3,4-trifluorophenyl)methyl]-3H-isoindol-1-one (PubChem CID 45271379) has the molecular formula C15H10F3NO3 and a molecular weight of 309.24 g/mol. Its IUPAC name is 6,7-dihydroxy-2-[(2,3,4-trifluorophenyl)methyl]-3H-isoindol-1-one.
| Compound Name | 6,7-dihydroxy-2-[(2,3,4-trifluorophenyl)methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 45271379 |
| Molecular Formula | C15H10F3NO3 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 6,7-dihydroxy-2-[(2,3,4-trifluorophenyl)methyl]-3H-isoindol-1-one |
| SMILES | O=C1c2c(ccc(O)c2O)CN1Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H10F3NO3/c16-9-3-1-8(12(17)13(9)18)6-19-5-7-2-4-10(20)14(21)11(7)15(19)22/h1-4,20-21H,5-6H2 |
| InChIKey | JXDHAQHESHLIOQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|