C33H34Cl3NO8S — CID 45273850
[(2R,3R,4S,5R)-4-acetyloxy-3-phenylmethoxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 45273850) has the molecular formula C33H34Cl3NO8S and a molecular weight of 711.06 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4-acetyloxy-3-phenylmethoxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-4-acetyloxy-3-phenylmethoxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 45273850 |
| Molecular Formula | C33H34Cl3NO8S |
| Molecular Weight | 711.06 g/mol |
| Exact Mass | 709.11 |
| IUPAC Name | [(2R,3R,4S,5R)-4-acetyloxy-3-phenylmethoxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/OC1O[C@H](COC(C)=O)[C@@H](OCc2ccccc2)[C@H](OC(C)=O)[C@H]1O[C@H](CSc1ccccc1)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C33H34Cl3NO8S/c1-21(38)40-19-26-28(41-18-23-12-6-3-7-13-23)29(42-22(2)39)30(31(44-26)45-32(37)33(34,35)36)43-27(24-14-8-4-9-15-24)20-46-25-16-10-5-11-17-25/h3-17,26-31,37H,18-20H2,1-2H3/b37-32+/t26-,27-,28-,29+,30-,31?/m1/s1 |
| InChIKey | BRSWWJALGIFURN-MNRLPZCASA-N |
| XLogP | 7.07 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.06 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|