C28H30Cl3NO9S — CID 11636040
[(2R,3S,4S,5R,6R)-3,4-diacetyloxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 11636040) has the molecular formula C28H30Cl3NO9S and a molecular weight of 662.97 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4-diacetyloxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4-diacetyloxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11636040 |
| Molecular Formula | C28H30Cl3NO9S |
| Molecular Weight | 662.97 g/mol |
| Exact Mass | 661.07 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4-diacetyloxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1O[C@H](CSc1ccccc1)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C28H30Cl3NO9S/c1-16(33)36-14-21-23(37-17(2)34)24(38-18(3)35)25(26(40-21)41-27(32)28(29,30)31)39-22(19-10-6-4-7-11-19)15-42-20-12-8-5-9-13-20/h4-13,21-26,32H,14-15H2,1-3H3/b32-27+/t21-,22-,23+,24+,25-,26-/m1/s1 |
| InChIKey | MKYCJBXDPPPDSH-BWBNGSTGSA-N |
| XLogP | 5.42 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.97 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|