C24H52O4Si3 — CID 45275913
2-trimethylsilylethyl (E,3S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-enoate (PubChem CID 45275913) has the molecular formula C24H52O4Si3 and a molecular weight of 488.93 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E,3S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-enoate.
| Compound Name | 2-trimethylsilylethyl (E,3S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-enoate |
|---|---|
| PubChem CID | 45275913 |
| Molecular Formula | C24H52O4Si3 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | 2-trimethylsilylethyl (E,3S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]hept-4-enoate |
| SMILES | CC(C)(C)[Si](C)(C)OCC/C=C/[C@H](CC(=O)OCC[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H52O4Si3/c1-23(2,3)30(10,11)27-17-15-14-16-21(28-31(12,13)24(4,5)6)20-22(25)26-18-19-29(7,8)9/h14,16,21H,15,17-20H2,1-13H3/b16-14+/t21-/m1/s1 |
| InChIKey | OPHIMWHIRBBEOL-DGWAXEAPSA-N |
| XLogP | 7.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|