C17H30O2Si — CID 45276480
(1R,3aS,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 45276480) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is (1R,3aS,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (1R,3aS,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 45276480 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (1R,3aS,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-prop-2-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | C=CC[C@H]1C(=O)C[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]21 |
| InChI | InChI=1S/C17H30O2Si/c1-7-8-14-15-11-13(9-12(15)10-16(14)18)19-20(5,6)17(2,3)4/h7,12-15H,1,8-11H2,2-6H3/t12-,13-,14+,15-/m0/s1 |
| InChIKey | JPIJGEFZRVCEKM-XQLPTFJDSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|