C28H29ClN4O2 — CID 45277116
N-tert-butyl-2-(N-(4-chlorobenzoyl)anilino)-3-ethyl-4H-quinazoline-4-carboxamide (PubChem CID 45277116) has the molecular formula C28H29ClN4O2 and a molecular weight of 489.02 g/mol. Its IUPAC name is N-tert-butyl-2-(N-(4-chlorobenzoyl)anilino)-3-ethyl-4H-quinazoline-4-carboxamide.
| Compound Name | N-tert-butyl-2-(N-(4-chlorobenzoyl)anilino)-3-ethyl-4H-quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 45277116 |
| Molecular Formula | C28H29ClN4O2 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-tert-butyl-2-(N-(4-chlorobenzoyl)anilino)-3-ethyl-4H-quinazoline-4-carboxamide |
| SMILES | CCN1C(N(C(=O)c2ccc(Cl)cc2)c2ccccc2)=Nc2ccccc2C1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C28H29ClN4O2/c1-5-32-24(25(34)31-28(2,3)4)22-13-9-10-14-23(22)30-27(32)33(21-11-7-6-8-12-21)26(35)19-15-17-20(29)18-16-19/h6-18,24H,5H2,1-4H3,(H,31,34) |
| InChIKey | WLNXYRNRKQDNMP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |