C26H24ClN3O2 — CID 139224863
2-benzoyl-N-butyl-3-(4-chlorophenyl)-4H-quinazoline-4-carboxamide (PubChem CID 139224863) has the molecular formula C26H24ClN3O2 and a molecular weight of 445.95 g/mol. Its IUPAC name is 2-benzoyl-N-butyl-3-(4-chlorophenyl)-4H-quinazoline-4-carboxamide.
| Compound Name | 2-benzoyl-N-butyl-3-(4-chlorophenyl)-4H-quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 139224863 |
| Molecular Formula | C26H24ClN3O2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-benzoyl-N-butyl-3-(4-chlorophenyl)-4H-quinazoline-4-carboxamide |
| SMILES | CCCCNC(=O)C1c2ccccc2N=C(C(=O)c2ccccc2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24ClN3O2/c1-2-3-17-28-26(32)23-21-11-7-8-12-22(21)29-25(24(31)18-9-5-4-6-10-18)30(23)20-15-13-19(27)14-16-20/h4-16,23H,2-3,17H2,1H3,(H,28,32) |
| InChIKey | FTJDTMMDZPOUSL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|