C27H29NO3S — CID 45277505
(3aS,4S,7aS)-4-benzhydryl-1-(4-methylphenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole (PubChem CID 45277505) has the molecular formula C27H29NO3S and a molecular weight of 447.60 g/mol. Its IUPAC name is (3aS,4S,7aS)-4-benzhydryl-1-(4-methylphenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole.
| Compound Name | (3aS,4S,7aS)-4-benzhydryl-1-(4-methylphenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole |
|---|---|
| PubChem CID | 45277505 |
| Molecular Formula | C27H29NO3S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | (3aS,4S,7aS)-4-benzhydryl-1-(4-methylphenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-pyrano[4,3-b]pyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H]3[C@H](C(c4ccccc4)c4ccccc4)OCC[C@@H]32)cc1 |
| InChI | InChI=1S/C27H29NO3S/c1-20-12-14-23(15-13-20)32(29,30)28-18-16-24-25(28)17-19-31-27(24)26(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15,24-27H,16-19H2,1H3/t24-,25-,27+/m0/s1 |
| InChIKey | UMMZQXJXANXBGI-OHSXHVKISA-N |
| XLogP | 5.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |