C20H22FNO2S2 — CID 71734664
(3aR,4R,7aS)-4-(2-fluorophenyl)-1-(4-methylphenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]pyrrole (PubChem CID 71734664) has the molecular formula C20H22FNO2S2 and a molecular weight of 391.53 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-(2-fluorophenyl)-1-(4-methylphenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]pyrrole.
| Compound Name | (3aR,4R,7aS)-4-(2-fluorophenyl)-1-(4-methylphenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]pyrrole |
|---|---|
| PubChem CID | 71734664 |
| Molecular Formula | C20H22FNO2S2 |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (3aR,4R,7aS)-4-(2-fluorophenyl)-1-(4-methylphenyl)sulfonyl-3,3a,4,6,7,7a-hexahydro-2H-thiopyrano[4,3-b]pyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H]3[C@H](c4ccccc4F)SCC[C@@H]32)cc1 |
| InChI | InChI=1S/C20H22FNO2S2/c1-14-6-8-15(9-7-14)26(23,24)22-12-10-17-19(22)11-13-25-20(17)16-4-2-3-5-18(16)21/h2-9,17,19-20H,10-13H2,1H3/t17-,19+,20+/m1/s1 |
| InChIKey | CBYRJXOSVGZOGI-HOJAQTOUSA-N |
| XLogP | 4.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |