C14H26N2O2 — CID 45282967
[5-(2-ethylhexoxy)-1,3-dimethylpyrazol-4-yl]methanol (PubChem CID 45282967) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is [5-(2-ethylhexoxy)-1,3-dimethylpyrazol-4-yl]methanol.
| Compound Name | [5-(2-ethylhexoxy)-1,3-dimethylpyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 45282967 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | [5-(2-ethylhexoxy)-1,3-dimethylpyrazol-4-yl]methanol |
| SMILES | CCCCC(CC)COc1c(CO)c(C)nn1C |
| InChI | InChI=1S/C14H26N2O2/c1-5-7-8-12(6-2)10-18-14-13(9-17)11(3)15-16(14)4/h12,17H,5-10H2,1-4H3 |
| InChIKey | AMDXJLGWMHMFER-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |