C24H24F3N3O2 — CID 45352160
2-(2-acetyl-1H-isoquinolin-1-yl)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone (PubChem CID 45352160) has the molecular formula C24H24F3N3O2 and a molecular weight of 443.47 g/mol. Its IUPAC name is 2-(2-acetyl-1H-isoquinolin-1-yl)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 45352160 |
| Molecular Formula | C24H24F3N3O2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-(2-acetyl-1H-isoquinolin-1-yl)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1C=Cc2ccccc2C1CC(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H24F3N3O2/c1-17(31)30-10-9-18-5-2-3-8-21(18)22(30)16-23(32)29-13-11-28(12-14-29)20-7-4-6-19(15-20)24(25,26)27/h2-10,15,22H,11-14,16H2,1H3 |
| InChIKey | ZATITVZFUJWUDH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |