C24H33N3O5S — CID 45352505
[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 2-(3-hydroxy-1-adamantyl)acetate (PubChem CID 45352505) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 2-(3-hydroxy-1-adamantyl)acetate.
| Compound Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 2-(3-hydroxy-1-adamantyl)acetate |
|---|---|
| PubChem CID | 45352505 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl 2-(3-hydroxy-1-adamantyl)acetate |
| SMILES | CCn1c(COC(=O)CC23CC4CC(CC(O)(C4)C2)C3)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C24H33N3O5S/c1-4-27-20-6-5-18(33(30,31)26(2)3)8-19(20)25-21(27)14-32-22(28)13-23-9-16-7-17(10-23)12-24(29,11-16)15-23/h5-6,8,16-17,29H,4,7,9-15H2,1-3H3 |
| InChIKey | CRXUPJTXTOBFTR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |