C23H30ClN3O4S — CID 98237737
[5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl (5R,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 98237737) has the molecular formula C23H30ClN3O4S and a molecular weight of 480.03 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl (5R,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl (5R,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98237737 |
| Molecular Formula | C23H30ClN3O4S |
| Molecular Weight | 480.03 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | [5-(dimethylsulfamoyl)-1-ethylbenzimidazol-2-yl]methyl (5R,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | CCn1c(COC(=O)C23C[C@H]4C[C@@H](CC(Cl)(C4)C2)C3)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C23H30ClN3O4S/c1-4-27-19-6-5-17(32(29,30)26(2)3)8-18(19)25-20(27)13-31-21(28)22-9-15-7-16(10-22)12-23(24,11-15)14-22/h5-6,8,15-16H,4,7,9-14H2,1-3H3/t15-,16-,22?,23?/m1/s1 |
| InChIKey | JQMXEKKPKGRQFM-SNTCSEMISA-N |
| XLogP | 3.93 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.03 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|