C21H28N4O3S2 — CID 45369731
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-2-(benzenesulfonamido)-5-methyl-1,3-thiazole-4-carboxamide (PubChem CID 45369731) has the molecular formula C21H28N4O3S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-2-(benzenesulfonamido)-5-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-2-(benzenesulfonamido)-5-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 45369731 |
| Molecular Formula | C21H28N4O3S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-2-(benzenesulfonamido)-5-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1sc(NS(=O)(=O)c2ccccc2)nc1C(=O)NCC1CCCN2CCCCC12 |
| InChI | InChI=1S/C21H28N4O3S2/c1-15-19(23-21(29-15)24-30(27,28)17-9-3-2-4-10-17)20(26)22-14-16-8-7-13-25-12-6-5-11-18(16)25/h2-4,9-10,16,18H,5-8,11-14H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | ZMCNYETUWKPMMC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |