C12H8N6S — CID 45486143
10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-4-thione (PubChem CID 45486143) has the molecular formula C12H8N6S and a molecular weight of 268.31 g/mol. Its IUPAC name is 10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-4-thione.
| Compound Name | 10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-4-thione |
|---|---|
| PubChem CID | 45486143 |
| Molecular Formula | C12H8N6S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,11-tetraene-4-thione |
| SMILES | S=c1nc2c3cnn(-c4ccccc4)c3ncn2[nH]1 |
| InChI | InChI=1S/C12H8N6S/c19-12-15-11-9-6-14-18(8-4-2-1-3-5-8)10(9)13-7-17(11)16-12/h1-7H,(H,16,19) |
| InChIKey | YEFXMQHFSBLHAD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|