C15H13ClN8 — CID 78364887
4-(4-chloropyrazolidin-3-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 78364887) has the molecular formula C15H13ClN8 and a molecular weight of 340.78 g/mol. Its IUPAC name is 4-(4-chloropyrazolidin-3-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-(4-chloropyrazolidin-3-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 78364887 |
| Molecular Formula | C15H13ClN8 |
| Molecular Weight | 340.78 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-(4-chloropyrazolidin-3-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | ClC1CNNC1c1nc2c3cnn(-c4ccccc4)c3ncn2n1 |
| InChI | InChI=1S/C15H13ClN8/c16-11-7-18-21-12(11)13-20-15-10-6-19-24(9-4-2-1-3-5-9)14(10)17-8-23(15)22-13/h1-6,8,11-12,18,21H,7H2 |
| InChIKey | HJNCPIJYESCOID-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.78 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|