C23H22N10 — CID 98337502
10-phenyl-4-[(5R,7R)-3-(tetrazol-2-yl)-1-adamantyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 98337502) has the molecular formula C23H22N10 and a molecular weight of 438.50 g/mol. Its IUPAC name is 10-phenyl-4-[(5R,7R)-3-(tetrazol-2-yl)-1-adamantyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-phenyl-4-[(5R,7R)-3-(tetrazol-2-yl)-1-adamantyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 98337502 |
| Molecular Formula | C23H22N10 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 10-phenyl-4-[(5R,7R)-3-(tetrazol-2-yl)-1-adamantyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | c1ccc(-n2ncc3c2ncn2nc(C45C[C@H]6C[C@H](C4)CC(n4ncnn4)(C6)C5)nc32)cc1 |
| InChI | InChI=1S/C23H22N10/c1-2-4-17(5-3-1)32-19-18(11-26-32)20-28-21(29-31(20)14-24-19)22-7-15-6-16(8-22)10-23(9-15,12-22)33-27-13-25-30-33/h1-5,11,13-16H,6-10,12H2/t15-,16-,22?,23?/m1/s1 |
| InChIKey | UBTRKVIBOGIAKP-SNTCSEMISA-N |
| XLogP | 2.70 |
| TPSA | 104.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |