C19H21N7O2S — CID 19584175
4-(1-ethylsulfonylpiperidin-3-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 19584175) has the molecular formula C19H21N7O2S and a molecular weight of 411.49 g/mol. Its IUPAC name is 4-(1-ethylsulfonylpiperidin-3-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-(1-ethylsulfonylpiperidin-3-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 19584175 |
| Molecular Formula | C19H21N7O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-(1-ethylsulfonylpiperidin-3-yl)-10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCS(=O)(=O)N1CCCC(c2nc3c4cnn(-c5ccccc5)c4ncn3n2)C1 |
| InChI | InChI=1S/C19H21N7O2S/c1-2-29(27,28)24-10-6-7-14(12-24)17-22-19-16-11-21-26(15-8-4-3-5-9-15)18(16)20-13-25(19)23-17/h3-5,8-9,11,13-14H,2,6-7,10,12H2,1H3 |
| InChIKey | WIXKMZYVGVKHJL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 98.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |