C23H26FN5O2S — CID 45499418
2-[4-(2-fluorophenyl)piperazin-1-yl]-6-piperidin-1-ylsulfonylquinoxaline (PubChem CID 45499418) has the molecular formula C23H26FN5O2S and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-6-piperidin-1-ylsulfonylquinoxaline.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-6-piperidin-1-ylsulfonylquinoxaline |
|---|---|
| PubChem CID | 45499418 |
| Molecular Formula | C23H26FN5O2S |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-6-piperidin-1-ylsulfonylquinoxaline |
| SMILES | O=S(=O)(c1ccc2nc(N3CCN(c4ccccc4F)CC3)cnc2c1)N1CCCCC1 |
| InChI | InChI=1S/C23H26FN5O2S/c24-19-6-2-3-7-22(19)27-12-14-28(15-13-27)23-17-25-21-16-18(8-9-20(21)26-23)32(30,31)29-10-4-1-5-11-29/h2-3,6-9,16-17H,1,4-5,10-15H2 |
| InChIKey | IABXHDRDUNXECR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |